C32H36N6O2 — CID 43820279
2-[[2-(benzotriazol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]-2-cyclohex-3-en-1-yl-N-[4-(dimethylamino)phenyl]acetamide (PubChem CID 43820279) has the molecular formula C32H36N6O2 and a molecular weight of 536.68 g/mol. Its IUPAC name is 2-[[2-(benzotriazol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]-2-cyclohex-3-en-1-yl-N-[4-(dimethylamino)phenyl]acetamide.
| Compound Name | 2-[[2-(benzotriazol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]-2-cyclohex-3-en-1-yl-N-[4-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 43820279 |
| Molecular Formula | C32H36N6O2 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | 2-[[2-(benzotriazol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]-2-cyclohex-3-en-1-yl-N-[4-(dimethylamino)phenyl]acetamide |
| SMILES | Cc1ccc(CN(C(=O)Cn2nnc3ccccc32)C(C(=O)Nc2ccc(N(C)C)cc2)C2CC=CCC2)cc1 |
| InChI | InChI=1S/C32H36N6O2/c1-23-13-15-24(16-14-23)21-37(30(39)22-38-29-12-8-7-11-28(29)34-35-38)31(25-9-5-4-6-10-25)32(40)33-26-17-19-27(20-18-26)36(2)3/h4-5,7-8,11-20,25,31H,6,9-10,21-22H2,1-3H3,(H,33,40) |
| InChIKey | MFDGFBXQPJEXGE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|