C30H29N7O2 — CID 44537519
2-[[2-(benzotriazol-1-yl)acetyl]-(pyridin-3-ylmethyl)amino]-N-[4-(dimethylamino)phenyl]-2-phenylacetamide (PubChem CID 44537519) has the molecular formula C30H29N7O2 and a molecular weight of 519.61 g/mol. Its IUPAC name is 2-[[2-(benzotriazol-1-yl)acetyl]-(pyridin-3-ylmethyl)amino]-N-[4-(dimethylamino)phenyl]-2-phenylacetamide.
| Compound Name | 2-[[2-(benzotriazol-1-yl)acetyl]-(pyridin-3-ylmethyl)amino]-N-[4-(dimethylamino)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 44537519 |
| Molecular Formula | C30H29N7O2 |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | 2-[[2-(benzotriazol-1-yl)acetyl]-(pyridin-3-ylmethyl)amino]-N-[4-(dimethylamino)phenyl]-2-phenylacetamide |
| SMILES | CN(C)c1ccc(NC(=O)C(c2ccccc2)N(Cc2cccnc2)C(=O)Cn2nnc3ccccc32)cc1 |
| InChI | InChI=1S/C30H29N7O2/c1-35(2)25-16-14-24(15-17-25)32-30(39)29(23-10-4-3-5-11-23)36(20-22-9-8-18-31-19-22)28(38)21-37-27-13-7-6-12-26(27)33-34-37/h3-19,29H,20-21H2,1-2H3,(H,32,39) |
| InChIKey | YNPYKAZCMORUAP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|