C33H34N6O4 — CID 4174248
2-[[2-(benzotriazol-1-yl)acetyl]-benzylamino]-2-(3,4-dimethoxyphenyl)-N-[4-(dimethylamino)phenyl]acetamide (PubChem CID 4174248) has the molecular formula C33H34N6O4 and a molecular weight of 578.67 g/mol. Its IUPAC name is 2-[[2-(benzotriazol-1-yl)acetyl]-benzylamino]-2-(3,4-dimethoxyphenyl)-N-[4-(dimethylamino)phenyl]acetamide.
| Compound Name | 2-[[2-(benzotriazol-1-yl)acetyl]-benzylamino]-2-(3,4-dimethoxyphenyl)-N-[4-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 4174248 |
| Molecular Formula | C33H34N6O4 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | 2-[[2-(benzotriazol-1-yl)acetyl]-benzylamino]-2-(3,4-dimethoxyphenyl)-N-[4-(dimethylamino)phenyl]acetamide |
| SMILES | COc1ccc(C(C(=O)Nc2ccc(N(C)C)cc2)N(Cc2ccccc2)C(=O)Cn2nnc3ccccc32)cc1OC |
| InChI | InChI=1S/C33H34N6O4/c1-37(2)26-17-15-25(16-18-26)34-33(41)32(24-14-19-29(42-3)30(20-24)43-4)38(21-23-10-6-5-7-11-23)31(40)22-39-28-13-9-8-12-27(28)35-36-39/h5-20,32H,21-22H2,1-4H3,(H,34,41) |
| InChIKey | UNSWWZRWENGKEX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|