C26H29N7O2 — CID 2723018
2-[[2-(benzotriazol-1-yl)acetyl]-(pyridin-3-ylmethyl)amino]-N-[4-(dimethylamino)phenyl]-2-methylpropanamide (PubChem CID 2723018) has the molecular formula C26H29N7O2 and a molecular weight of 471.57 g/mol. Its IUPAC name is 2-[[2-(benzotriazol-1-yl)acetyl]-(pyridin-3-ylmethyl)amino]-N-[4-(dimethylamino)phenyl]-2-methylpropanamide.
| Compound Name | 2-[[2-(benzotriazol-1-yl)acetyl]-(pyridin-3-ylmethyl)amino]-N-[4-(dimethylamino)phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 2723018 |
| Molecular Formula | C26H29N7O2 |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 2-[[2-(benzotriazol-1-yl)acetyl]-(pyridin-3-ylmethyl)amino]-N-[4-(dimethylamino)phenyl]-2-methylpropanamide |
| SMILES | CN(C)c1ccc(NC(=O)C(C)(C)N(Cc2cccnc2)C(=O)Cn2nnc3ccccc32)cc1 |
| InChI | InChI=1S/C26H29N7O2/c1-26(2,25(35)28-20-11-13-21(14-12-20)31(3)4)32(17-19-8-7-15-27-16-19)24(34)18-33-23-10-6-5-9-22(23)29-30-33/h5-16H,17-18H2,1-4H3,(H,28,35) |
| InChIKey | INEKZCVVWOMIMV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|