C29H34N6O2 — CID 43820297
2-[[2-(benzotriazol-1-yl)acetyl]-[(2-methylphenyl)methyl]amino]-N-[4-(dimethylamino)phenyl]-2-methylbutanamide (PubChem CID 43820297) has the molecular formula C29H34N6O2 and a molecular weight of 498.63 g/mol. Its IUPAC name is 2-[[2-(benzotriazol-1-yl)acetyl]-[(2-methylphenyl)methyl]amino]-N-[4-(dimethylamino)phenyl]-2-methylbutanamide.
| Compound Name | 2-[[2-(benzotriazol-1-yl)acetyl]-[(2-methylphenyl)methyl]amino]-N-[4-(dimethylamino)phenyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 43820297 |
| Molecular Formula | C29H34N6O2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 2-[[2-(benzotriazol-1-yl)acetyl]-[(2-methylphenyl)methyl]amino]-N-[4-(dimethylamino)phenyl]-2-methylbutanamide |
| SMILES | CCC(C)(C(=O)Nc1ccc(N(C)C)cc1)N(Cc1ccccc1C)C(=O)Cn1nnc2ccccc21 |
| InChI | InChI=1S/C29H34N6O2/c1-6-29(3,28(37)30-23-15-17-24(18-16-23)33(4)5)34(19-22-12-8-7-11-21(22)2)27(36)20-35-26-14-10-9-13-25(26)31-32-35/h7-18H,6,19-20H2,1-5H3,(H,30,37) |
| InChIKey | BTABFVYJXRBJNS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|