C28H31FN6O2 — CID 43820309
2-[[2-(benzotriazol-1-yl)acetyl]-[(2-fluorophenyl)methyl]amino]-N-[4-(dimethylamino)phenyl]-2-methylbutanamide (PubChem CID 43820309) has the molecular formula C28H31FN6O2 and a molecular weight of 502.59 g/mol. Its IUPAC name is 2-[[2-(benzotriazol-1-yl)acetyl]-[(2-fluorophenyl)methyl]amino]-N-[4-(dimethylamino)phenyl]-2-methylbutanamide.
| Compound Name | 2-[[2-(benzotriazol-1-yl)acetyl]-[(2-fluorophenyl)methyl]amino]-N-[4-(dimethylamino)phenyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 43820309 |
| Molecular Formula | C28H31FN6O2 |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | 2-[[2-(benzotriazol-1-yl)acetyl]-[(2-fluorophenyl)methyl]amino]-N-[4-(dimethylamino)phenyl]-2-methylbutanamide |
| SMILES | CCC(C)(C(=O)Nc1ccc(N(C)C)cc1)N(Cc1ccccc1F)C(=O)Cn1nnc2ccccc21 |
| InChI | InChI=1S/C28H31FN6O2/c1-5-28(2,27(37)30-21-14-16-22(17-15-21)33(3)4)34(18-20-10-6-7-11-23(20)29)26(36)19-35-25-13-9-8-12-24(25)31-32-35/h6-17H,5,18-19H2,1-4H3,(H,30,37) |
| InChIKey | TXNSUPZSYVKNNA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|