C30H33FN6O3 — CID 5005853
2-[[2-(benzotriazol-1-yl)acetyl]-[(2-fluorophenyl)methyl]amino]-2-methyl-N-(4-morpholin-4-ylphenyl)butanamide (PubChem CID 5005853) has the molecular formula C30H33FN6O3 and a molecular weight of 544.63 g/mol. Its IUPAC name is 2-[[2-(benzotriazol-1-yl)acetyl]-[(2-fluorophenyl)methyl]amino]-2-methyl-N-(4-morpholin-4-ylphenyl)butanamide.
| Compound Name | 2-[[2-(benzotriazol-1-yl)acetyl]-[(2-fluorophenyl)methyl]amino]-2-methyl-N-(4-morpholin-4-ylphenyl)butanamide |
|---|---|
| PubChem CID | 5005853 |
| Molecular Formula | C30H33FN6O3 |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | 2-[[2-(benzotriazol-1-yl)acetyl]-[(2-fluorophenyl)methyl]amino]-2-methyl-N-(4-morpholin-4-ylphenyl)butanamide |
| SMILES | CCC(C)(C(=O)Nc1ccc(N2CCOCC2)cc1)N(Cc1ccccc1F)C(=O)Cn1nnc2ccccc21 |
| InChI | InChI=1S/C30H33FN6O3/c1-3-30(2,29(39)32-23-12-14-24(15-13-23)35-16-18-40-19-17-35)36(20-22-8-4-5-9-25(22)31)28(38)21-37-27-11-7-6-10-26(27)33-34-37/h4-15H,3,16-21H2,1-2H3,(H,32,39) |
| InChIKey | JANLFOUVALKMGW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|