C33H31FN6O3 — CID 98460675
(2S)-2-[[2-(benzotriazol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)-2-phenylacetamide (PubChem CID 98460675) has the molecular formula C33H31FN6O3 and a molecular weight of 578.65 g/mol. Its IUPAC name is (2S)-2-[[2-(benzotriazol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)-2-phenylacetamide.
| Compound Name | (2S)-2-[[2-(benzotriazol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 98460675 |
| Molecular Formula | C33H31FN6O3 |
| Molecular Weight | 578.65 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | (2S)-2-[[2-(benzotriazol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)-2-phenylacetamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1)[C@H](c1ccccc1)N(Cc1ccc(F)cc1)C(=O)Cn1nnc2ccccc21 |
| InChI | InChI=1S/C33H31FN6O3/c34-26-12-10-24(11-13-26)22-39(31(41)23-40-30-9-5-4-8-29(30)36-37-40)32(25-6-2-1-3-7-25)33(42)35-27-14-16-28(17-15-27)38-18-20-43-21-19-38/h1-17,32H,18-23H2,(H,35,42)/t32-/m0/s1 |
| InChIKey | GJSNLDGVGDRPQK-YTTGMZPUSA-N |
| XLogP | 4.82 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.65 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|