C34H34FN3O3 — CID 98460831
(2R)-2-[(4-fluorophenyl)methyl-(2-phenylacetyl)amino]-2-(4-methylphenyl)-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 98460831) has the molecular formula C34H34FN3O3 and a molecular weight of 551.66 g/mol. Its IUPAC name is (2R)-2-[(4-fluorophenyl)methyl-(2-phenylacetyl)amino]-2-(4-methylphenyl)-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | (2R)-2-[(4-fluorophenyl)methyl-(2-phenylacetyl)amino]-2-(4-methylphenyl)-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 98460831 |
| Molecular Formula | C34H34FN3O3 |
| Molecular Weight | 551.66 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | (2R)-2-[(4-fluorophenyl)methyl-(2-phenylacetyl)amino]-2-(4-methylphenyl)-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | Cc1ccc([C@H](C(=O)Nc2ccc(N3CCOCC3)cc2)N(Cc2ccc(F)cc2)C(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C34H34FN3O3/c1-25-7-11-28(12-8-25)33(34(40)36-30-15-17-31(18-16-30)37-19-21-41-22-20-37)38(24-27-9-13-29(35)14-10-27)32(39)23-26-5-3-2-4-6-26/h2-18,33H,19-24H2,1H3,(H,36,40)/t33-/m1/s1 |
| InChIKey | UGGYMPPUQJTMND-MGBGTMOVSA-N |
| XLogP | 5.92 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.66 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|