C37H36N4O5 — CID 43820047
2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]-2-(4-methylphenyl)-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 43820047) has the molecular formula C37H36N4O5 and a molecular weight of 616.72 g/mol. Its IUPAC name is 2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]-2-(4-methylphenyl)-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]-2-(4-methylphenyl)-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 43820047 |
| Molecular Formula | C37H36N4O5 |
| Molecular Weight | 616.72 g/mol |
| Exact Mass | 616.27 |
| IUPAC Name | 2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]-2-(4-methylphenyl)-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | Cc1ccc(CN(C(=O)CN2C(=O)C(=O)c3ccccc32)C(C(=O)Nc2ccc(N3CCOCC3)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C37H36N4O5/c1-25-7-11-27(12-8-25)23-41(33(42)24-40-32-6-4-3-5-31(32)35(43)37(40)45)34(28-13-9-26(2)10-14-28)36(44)38-29-15-17-30(18-16-29)39-19-21-46-22-20-39/h3-18,34H,19-24H2,1-2H3,(H,38,44) |
| InChIKey | DONRSTMVPMJKGQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.72 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|