C36H31FN4O7 — CID 43820093
2-(1,3-benzodioxol-5-yl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(2-fluorophenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 43820093) has the molecular formula C36H31FN4O7 and a molecular weight of 650.66 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(2-fluorophenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(2-fluorophenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 43820093 |
| Molecular Formula | C36H31FN4O7 |
| Molecular Weight | 650.66 g/mol |
| Exact Mass | 650.22 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(2-fluorophenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | O=C1C(=O)N(CC(=O)N(Cc2ccccc2F)C(C(=O)Nc2ccc(N3CCOCC3)cc2)c2ccc3c(c2)OCO3)c2ccccc21 |
| InChI | InChI=1S/C36H31FN4O7/c37-28-7-3-1-5-24(28)20-41(32(42)21-40-29-8-4-2-6-27(29)34(43)36(40)45)33(23-9-14-30-31(19-23)48-22-47-30)35(44)38-25-10-12-26(13-11-25)39-15-17-46-18-16-39/h1-14,19,33H,15-18,20-22H2,(H,38,44) |
| InChIKey | RJFVBQILOOOQTL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.66 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|