C37H34N4O8 — CID 43820112
2-(1,3-benzodioxol-5-yl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methoxyphenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 43820112) has the molecular formula C37H34N4O8 and a molecular weight of 662.70 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methoxyphenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methoxyphenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 43820112 |
| Molecular Formula | C37H34N4O8 |
| Molecular Weight | 662.70 g/mol |
| Exact Mass | 662.24 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methoxyphenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | COc1ccc(CN(C(=O)CN2C(=O)C(=O)c3ccccc32)C(C(=O)Nc2ccc(N3CCOCC3)cc2)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C37H34N4O8/c1-46-28-13-6-24(7-14-28)21-41(33(42)22-40-30-5-3-2-4-29(30)35(43)37(40)45)34(25-8-15-31-32(20-25)49-23-48-31)36(44)38-26-9-11-27(12-10-26)39-16-18-47-19-17-39/h2-15,20,34H,16-19,21-23H2,1H3,(H,38,44) |
| InChIKey | JKNWUVPZAOBDRU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.70 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|