C35H33N3O5 — CID 2721651
(2R)-2-[benzyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-(4-methoxyphenyl)-2-(4-propan-2-ylphenyl)acetamide (PubChem CID 2721651) has the molecular formula C35H33N3O5 and a molecular weight of 575.67 g/mol. Its IUPAC name is (2R)-2-[benzyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-(4-methoxyphenyl)-2-(4-propan-2-ylphenyl)acetamide.
| Compound Name | (2R)-2-[benzyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-(4-methoxyphenyl)-2-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 2721651 |
| Molecular Formula | C35H33N3O5 |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | (2R)-2-[benzyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-(4-methoxyphenyl)-2-(4-propan-2-ylphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)[C@@H](c2ccc(C(C)C)cc2)N(Cc2ccccc2)C(=O)CN2C(=O)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C35H33N3O5/c1-23(2)25-13-15-26(16-14-25)32(34(41)36-27-17-19-28(43-3)20-18-27)38(21-24-9-5-4-6-10-24)31(39)22-37-30-12-8-7-11-29(30)33(40)35(37)42/h4-20,23,32H,21-22H2,1-3H3,(H,36,41)/t32-/m1/s1 |
| InChIKey | UOXLNMXIPYQBFD-JGCGQSQUSA-N |
| XLogP | 5.76 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|