C33H27N3O7 — CID 43819912
N-(1,3-benzodioxol-5-yl)-2-[benzyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-2-(3-methoxyphenyl)acetamide (PubChem CID 43819912) has the molecular formula C33H27N3O7 and a molecular weight of 577.59 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[benzyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-2-(3-methoxyphenyl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[benzyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-2-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 43819912 |
| Molecular Formula | C33H27N3O7 |
| Molecular Weight | 577.59 g/mol |
| Exact Mass | 577.18 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[benzyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-2-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(C(C(=O)Nc2ccc3c(c2)OCO3)N(Cc2ccccc2)C(=O)CN2C(=O)C(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C33H27N3O7/c1-41-24-11-7-10-22(16-24)30(32(39)34-23-14-15-27-28(17-23)43-20-42-27)36(18-21-8-3-2-4-9-21)29(37)19-35-26-13-6-5-12-25(26)31(38)33(35)40/h2-17,30H,18-20H2,1H3,(H,34,39) |
| InChIKey | AWFPGGQEQMZGLE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|