C33H26ClN3O7 — CID 43819982
N-(1,3-benzodioxol-5-yl)-2-[(4-chlorophenyl)methyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-2-(4-methoxyphenyl)acetamide (PubChem CID 43819982) has the molecular formula C33H26ClN3O7 and a molecular weight of 612.04 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[(4-chlorophenyl)methyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[(4-chlorophenyl)methyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 43819982 |
| Molecular Formula | C33H26ClN3O7 |
| Molecular Weight | 612.04 g/mol |
| Exact Mass | 611.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[(4-chlorophenyl)methyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(C(C(=O)Nc2ccc3c(c2)OCO3)N(Cc2ccc(Cl)cc2)C(=O)CN2C(=O)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C33H26ClN3O7/c1-42-24-13-8-21(9-14-24)30(32(40)35-23-12-15-27-28(16-23)44-19-43-27)37(17-20-6-10-22(34)11-7-20)29(38)18-36-26-5-3-2-4-25(26)31(39)33(36)41/h2-16,30H,17-19H2,1H3,(H,35,40) |
| InChIKey | FODQNWSVMXRHBF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.04 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|