C33H28ClN3O6 — CID 43819499
2-[(4-chlorophenyl)methyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N,2-bis(4-methoxyphenyl)acetamide (PubChem CID 43819499) has the molecular formula C33H28ClN3O6 and a molecular weight of 598.06 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N,2-bis(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(4-chlorophenyl)methyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N,2-bis(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 43819499 |
| Molecular Formula | C33H28ClN3O6 |
| Molecular Weight | 598.06 g/mol |
| Exact Mass | 597.17 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N,2-bis(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)C(c2ccc(OC)cc2)N(Cc2ccc(Cl)cc2)C(=O)CN2C(=O)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C33H28ClN3O6/c1-42-25-15-9-22(10-16-25)30(32(40)35-24-13-17-26(43-2)18-14-24)37(19-21-7-11-23(34)12-8-21)29(38)20-36-28-6-4-3-5-27(28)31(39)33(36)41/h3-18,30H,19-20H2,1-2H3,(H,35,40) |
| InChIKey | NPPMZJYGDFFIDS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.06 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|