C33H28FN3O5 — CID 43819547
2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(4-methoxyphenyl)-2-(4-methylphenyl)acetamide (PubChem CID 43819547) has the molecular formula C33H28FN3O5 and a molecular weight of 565.60 g/mol. Its IUPAC name is 2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(4-methoxyphenyl)-2-(4-methylphenyl)acetamide.
| Compound Name | 2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(4-methoxyphenyl)-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 43819547 |
| Molecular Formula | C33H28FN3O5 |
| Molecular Weight | 565.60 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | 2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(4-methoxyphenyl)-2-(4-methylphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)C(c2ccc(C)cc2)N(Cc2ccc(F)cc2)C(=O)CN2C(=O)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C33H28FN3O5/c1-21-7-11-23(12-8-21)30(32(40)35-25-15-17-26(42-2)18-16-25)37(19-22-9-13-24(34)14-10-22)29(38)20-36-28-6-4-3-5-27(28)31(39)33(36)41/h3-18,30H,19-20H2,1-2H3,(H,35,40) |
| InChIKey | BNOCOLAVNISPHZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.60 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|