C36H36N4O6 — CID 43819577
2-(3,4-dimethoxyphenyl)-N-[4-(dimethylamino)phenyl]-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]acetamide (PubChem CID 43819577) has the molecular formula C36H36N4O6 and a molecular weight of 620.71 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[4-(dimethylamino)phenyl]-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[4-(dimethylamino)phenyl]-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 43819577 |
| Molecular Formula | C36H36N4O6 |
| Molecular Weight | 620.71 g/mol |
| Exact Mass | 620.26 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[4-(dimethylamino)phenyl]-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]acetamide |
| SMILES | COc1ccc(C(C(=O)Nc2ccc(N(C)C)cc2)N(Cc2ccc(C)cc2)C(=O)CN2C(=O)C(=O)c3ccccc32)cc1OC |
| InChI | InChI=1S/C36H36N4O6/c1-23-10-12-24(13-11-23)21-40(32(41)22-39-29-9-7-6-8-28(29)34(42)36(39)44)33(25-14-19-30(45-4)31(20-25)46-5)35(43)37-26-15-17-27(18-16-26)38(2)3/h6-20,33H,21-22H2,1-5H3,(H,37,43) |
| InChIKey | JPHCJGAQFKUDEX-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.71 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|