C36H35ClN4O7 — CID 43819647
2-[(4-chlorophenyl)methyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-[4-(dimethylamino)phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 43819647) has the molecular formula C36H35ClN4O7 and a molecular weight of 671.15 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-[4-(dimethylamino)phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | 2-[(4-chlorophenyl)methyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-[4-(dimethylamino)phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 43819647 |
| Molecular Formula | C36H35ClN4O7 |
| Molecular Weight | 671.15 g/mol |
| Exact Mass | 670.22 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-[4-(dimethylamino)phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(C(C(=O)Nc2ccc(N(C)C)cc2)N(Cc2ccc(Cl)cc2)C(=O)CN2C(=O)C(=O)c3ccccc32)cc(OC)c1OC |
| InChI | InChI=1S/C36H35ClN4O7/c1-39(2)26-16-14-25(15-17-26)38-35(44)32(23-18-29(46-3)34(48-5)30(19-23)47-4)41(20-22-10-12-24(37)13-11-22)31(42)21-40-28-9-7-6-8-27(28)33(43)36(40)45/h6-19,32H,20-21H2,1-5H3,(H,38,44) |
| InChIKey | IUHCQUAGEKGSGY-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.15 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|