C35H35N5O7 — CID 4319041
N-[4-(dimethylamino)phenyl]-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-(pyridin-3-ylmethyl)amino]-2-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 4319041) has the molecular formula C35H35N5O7 and a molecular weight of 637.69 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-(pyridin-3-ylmethyl)amino]-2-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-(pyridin-3-ylmethyl)amino]-2-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 4319041 |
| Molecular Formula | C35H35N5O7 |
| Molecular Weight | 637.69 g/mol |
| Exact Mass | 637.25 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-(pyridin-3-ylmethyl)amino]-2-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(C(C(=O)Nc2ccc(N(C)C)cc2)N(Cc2cccnc2)C(=O)CN2C(=O)C(=O)c3ccccc32)cc(OC)c1OC |
| InChI | InChI=1S/C35H35N5O7/c1-38(2)25-14-12-24(13-15-25)37-34(43)31(23-17-28(45-3)33(47-5)29(18-23)46-4)40(20-22-9-8-16-36-19-22)30(41)21-39-27-11-7-6-10-26(27)32(42)35(39)44/h6-19,31H,20-21H2,1-5H3,(H,37,43) |
| InChIKey | BEAMIHQXHMAWHZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.69 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|