C31H24N4O6 — CID 2722613
(2S)-N-(1,3-benzodioxol-5-yl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-(pyridin-3-ylmethyl)amino]-2-phenylacetamide (PubChem CID 2722613) has the molecular formula C31H24N4O6 and a molecular weight of 548.56 g/mol. Its IUPAC name is (2S)-N-(1,3-benzodioxol-5-yl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-(pyridin-3-ylmethyl)amino]-2-phenylacetamide.
| Compound Name | (2S)-N-(1,3-benzodioxol-5-yl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-(pyridin-3-ylmethyl)amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 2722613 |
| Molecular Formula | C31H24N4O6 |
| Molecular Weight | 548.56 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | (2S)-N-(1,3-benzodioxol-5-yl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-(pyridin-3-ylmethyl)amino]-2-phenylacetamide |
| SMILES | O=C1C(=O)N(CC(=O)N(Cc2cccnc2)[C@H](C(=O)Nc2ccc3c(c2)OCO3)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C31H24N4O6/c36-27(18-34-24-11-5-4-10-23(24)29(37)31(34)39)35(17-20-7-6-14-32-16-20)28(21-8-2-1-3-9-21)30(38)33-22-12-13-25-26(15-22)41-19-40-25/h1-16,28H,17-19H2,(H,33,38)/t28-/m0/s1 |
| InChIKey | AKGMUVXMYCCWGJ-NDEPHWFRSA-N |
| XLogP | 3.75 |
| TPSA | 118.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.56 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|