C28H25N3O6 — CID 43819905
N-(1,3-benzodioxol-5-yl)-2-[benzyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]butanamide (PubChem CID 43819905) has the molecular formula C28H25N3O6 and a molecular weight of 499.52 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[benzyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]butanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[benzyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 43819905 |
| Molecular Formula | C28H25N3O6 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[benzyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]butanamide |
| SMILES | CCC(C(=O)Nc1ccc2c(c1)OCO2)N(Cc1ccccc1)C(=O)CN1C(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C28H25N3O6/c1-2-21(27(34)29-19-12-13-23-24(14-19)37-17-36-23)30(15-18-8-4-3-5-9-18)25(32)16-31-22-11-7-6-10-20(22)26(33)28(31)35/h3-14,21H,2,15-17H2,1H3,(H,29,34) |
| InChIKey | SXJVREWIYOFQTJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|