C28H26ClN3O5 — CID 4128731
2-[(4-chlorophenyl)methyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-(4-methoxyphenyl)butanamide (PubChem CID 4128731) has the molecular formula C28H26ClN3O5 and a molecular weight of 519.99 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-(4-methoxyphenyl)butanamide.
| Compound Name | 2-[(4-chlorophenyl)methyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-(4-methoxyphenyl)butanamide |
|---|---|
| PubChem CID | 4128731 |
| Molecular Formula | C28H26ClN3O5 |
| Molecular Weight | 519.99 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-(4-methoxyphenyl)butanamide |
| SMILES | CCC(C(=O)Nc1ccc(OC)cc1)N(Cc1ccc(Cl)cc1)C(=O)CN1C(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C28H26ClN3O5/c1-3-23(27(35)30-20-12-14-21(37-2)15-13-20)31(16-18-8-10-19(29)11-9-18)25(33)17-32-24-7-5-4-6-22(24)26(34)28(32)36/h4-15,23H,3,16-17H2,1-2H3,(H,30,35) |
| InChIKey | LUEIDATUJYUWCV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.99 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|