C33H33N3O6 — CID 3631672
2-cyclohex-3-en-1-yl-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methoxyphenyl)methyl]amino]-N-(4-methoxyphenyl)acetamide (PubChem CID 3631672) has the molecular formula C33H33N3O6 and a molecular weight of 567.64 g/mol. Its IUPAC name is 2-cyclohex-3-en-1-yl-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methoxyphenyl)methyl]amino]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-cyclohex-3-en-1-yl-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methoxyphenyl)methyl]amino]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 3631672 |
| Molecular Formula | C33H33N3O6 |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | 2-cyclohex-3-en-1-yl-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methoxyphenyl)methyl]amino]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CN(C(=O)CN2C(=O)C(=O)c3ccccc32)C(C(=O)Nc2ccc(OC)cc2)C2CC=CCC2)cc1 |
| InChI | InChI=1S/C33H33N3O6/c1-41-25-16-12-22(13-17-25)20-36(29(37)21-35-28-11-7-6-10-27(28)31(38)33(35)40)30(23-8-4-3-5-9-23)32(39)34-24-14-18-26(42-2)19-15-24/h3-4,6-7,10-19,23,30H,5,8-9,20-21H2,1-2H3,(H,34,39) |
| InChIKey | KHZOYVBHMJIPOT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|