C34H35N3O7 — CID 43819786
2-cyclohex-3-en-1-yl-N-(2,4-dimethoxyphenyl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methoxyphenyl)methyl]amino]acetamide (PubChem CID 43819786) has the molecular formula C34H35N3O7 and a molecular weight of 597.67 g/mol. Its IUPAC name is 2-cyclohex-3-en-1-yl-N-(2,4-dimethoxyphenyl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methoxyphenyl)methyl]amino]acetamide.
| Compound Name | 2-cyclohex-3-en-1-yl-N-(2,4-dimethoxyphenyl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methoxyphenyl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 43819786 |
| Molecular Formula | C34H35N3O7 |
| Molecular Weight | 597.67 g/mol |
| Exact Mass | 597.25 |
| IUPAC Name | 2-cyclohex-3-en-1-yl-N-(2,4-dimethoxyphenyl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methoxyphenyl)methyl]amino]acetamide |
| SMILES | COc1ccc(CN(C(=O)CN2C(=O)C(=O)c3ccccc32)C(C(=O)Nc2ccc(OC)cc2OC)C2CC=CCC2)cc1 |
| InChI | InChI=1S/C34H35N3O7/c1-42-24-15-13-22(14-16-24)20-37(30(38)21-36-28-12-8-7-11-26(28)32(39)34(36)41)31(23-9-5-4-6-10-23)33(40)35-27-18-17-25(43-2)19-29(27)44-3/h4-5,7-8,11-19,23,31H,6,9-10,20-21H2,1-3H3,(H,35,40) |
| InChIKey | USKGAAFTDKETNA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.67 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|