C36H32N4O6 — CID 43819740
N-(2,4-dimethoxyphenyl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]-2-(1H-indol-3-yl)acetamide (PubChem CID 43819740) has the molecular formula C36H32N4O6 and a molecular weight of 616.67 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]-2-(1H-indol-3-yl)acetamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]-2-(1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 43819740 |
| Molecular Formula | C36H32N4O6 |
| Molecular Weight | 616.67 g/mol |
| Exact Mass | 616.23 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]-2-(1H-indol-3-yl)acetamide |
| SMILES | COc1ccc(NC(=O)C(c2c[nH]c3ccccc23)N(Cc2ccc(C)cc2)C(=O)CN2C(=O)C(=O)c3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C36H32N4O6/c1-22-12-14-23(15-13-22)20-40(32(41)21-39-30-11-7-5-9-26(30)34(42)36(39)44)33(27-19-37-28-10-6-4-8-25(27)28)35(43)38-29-17-16-24(45-2)18-31(29)46-3/h4-19,33,37H,20-21H2,1-3H3,(H,38,43) |
| InChIKey | GSPCXNPRSFGXOR-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 121.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.67 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|