C31H33N3O6 — CID 43819725
N-(2,4-dimethoxyphenyl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]-2-methylbutanamide (PubChem CID 43819725) has the molecular formula C31H33N3O6 and a molecular weight of 543.62 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]-2-methylbutanamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]-2-methylbutanamide |
|---|---|
| PubChem CID | 43819725 |
| Molecular Formula | C31H33N3O6 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]-2-methylbutanamide |
| SMILES | CCC(C)(C(=O)Nc1ccc(OC)cc1OC)N(Cc1ccc(C)cc1)C(=O)CN1C(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C31H33N3O6/c1-6-31(3,30(38)32-24-16-15-22(39-4)17-26(24)40-5)34(18-21-13-11-20(2)12-14-21)27(35)19-33-25-10-8-7-9-23(25)28(36)29(33)37/h7-17H,6,18-19H2,1-5H3,(H,32,38) |
| InChIKey | RECOYTLNGXQTFD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|