C30H31N3O5 — CID 43819463
2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(2-methylphenyl)methyl]amino]-N-(4-methoxyphenyl)-2-methylbutanamide (PubChem CID 43819463) has the molecular formula C30H31N3O5 and a molecular weight of 513.59 g/mol. Its IUPAC name is 2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(2-methylphenyl)methyl]amino]-N-(4-methoxyphenyl)-2-methylbutanamide.
| Compound Name | 2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(2-methylphenyl)methyl]amino]-N-(4-methoxyphenyl)-2-methylbutanamide |
|---|---|
| PubChem CID | 43819463 |
| Molecular Formula | C30H31N3O5 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(2-methylphenyl)methyl]amino]-N-(4-methoxyphenyl)-2-methylbutanamide |
| SMILES | CCC(C)(C(=O)Nc1ccc(OC)cc1)N(Cc1ccccc1C)C(=O)CN1C(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C30H31N3O5/c1-5-30(3,29(37)31-22-14-16-23(38-4)17-15-22)33(18-21-11-7-6-10-20(21)2)26(34)19-32-25-13-9-8-12-24(25)27(35)28(32)36/h6-17H,5,18-19H2,1-4H3,(H,31,37) |
| InChIKey | XRLJRJICLHTDFF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|