C30H31N3O6 — CID 2717853
(2R)-2-[benzyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-(2,4-dimethoxyphenyl)-2-methylbutanamide (PubChem CID 2717853) has the molecular formula C30H31N3O6 and a molecular weight of 529.59 g/mol. Its IUPAC name is (2R)-2-[benzyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-(2,4-dimethoxyphenyl)-2-methylbutanamide.
| Compound Name | (2R)-2-[benzyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-(2,4-dimethoxyphenyl)-2-methylbutanamide |
|---|---|
| PubChem CID | 2717853 |
| Molecular Formula | C30H31N3O6 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | (2R)-2-[benzyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-(2,4-dimethoxyphenyl)-2-methylbutanamide |
| SMILES | CC[C@](C)(C(=O)Nc1ccc(OC)cc1OC)N(Cc1ccccc1)C(=O)CN1C(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C30H31N3O6/c1-5-30(2,29(37)31-23-16-15-21(38-3)17-25(23)39-4)33(18-20-11-7-6-8-12-20)26(34)19-32-24-14-10-9-13-22(24)27(35)28(32)36/h6-17H,5,18-19H2,1-4H3,(H,31,37)/t30-/m1/s1 |
| InChIKey | RNVFQTKVZFPWHP-SSEXGKCCSA-N |
| XLogP | 4.07 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|