C30H29N3O6 — CID 43819920
N-(1,3-benzodioxol-5-yl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]-2-methylbutanamide (PubChem CID 43819920) has the molecular formula C30H29N3O6 and a molecular weight of 527.58 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]-2-methylbutanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]-2-methylbutanamide |
|---|---|
| PubChem CID | 43819920 |
| Molecular Formula | C30H29N3O6 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-methylphenyl)methyl]amino]-2-methylbutanamide |
| SMILES | CCC(C)(C(=O)Nc1ccc2c(c1)OCO2)N(Cc1ccc(C)cc1)C(=O)CN1C(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C30H29N3O6/c1-4-30(3,29(37)31-21-13-14-24-25(15-21)39-18-38-24)33(16-20-11-9-19(2)10-12-20)26(34)17-32-23-8-6-5-7-22(23)27(35)28(32)36/h5-15H,4,16-18H2,1-3H3,(H,31,37) |
| InChIKey | XZKBMCSBBWYPND-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|