C34H27N3O8 — CID 43819941
N,2-bis(1,3-benzodioxol-5-yl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(2-methylphenyl)methyl]amino]acetamide (PubChem CID 43819941) has the molecular formula C34H27N3O8 and a molecular weight of 605.60 g/mol. Its IUPAC name is N,2-bis(1,3-benzodioxol-5-yl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(2-methylphenyl)methyl]amino]acetamide.
| Compound Name | N,2-bis(1,3-benzodioxol-5-yl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(2-methylphenyl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 43819941 |
| Molecular Formula | C34H27N3O8 |
| Molecular Weight | 605.60 g/mol |
| Exact Mass | 605.18 |
| IUPAC Name | N,2-bis(1,3-benzodioxol-5-yl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(2-methylphenyl)methyl]amino]acetamide |
| SMILES | Cc1ccccc1CN(C(=O)CN1C(=O)C(=O)c2ccccc21)C(C(=O)Nc1ccc2c(c1)OCO2)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C34H27N3O8/c1-20-6-2-3-7-22(20)16-37(30(38)17-36-25-9-5-4-8-24(25)32(39)34(36)41)31(21-10-12-26-28(14-21)44-18-42-26)33(40)35-23-11-13-27-29(15-23)45-19-43-27/h2-15,31H,16-19H2,1H3,(H,35,40) |
| InChIKey | NYTGULFDEXICIC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.60 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|