C34H31FN4O4 — CID 43819590
N-[4-(dimethylamino)phenyl]-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(2-methylphenyl)methyl]amino]-2-(3-fluorophenyl)acetamide (PubChem CID 43819590) has the molecular formula C34H31FN4O4 and a molecular weight of 578.64 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(2-methylphenyl)methyl]amino]-2-(3-fluorophenyl)acetamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(2-methylphenyl)methyl]amino]-2-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 43819590 |
| Molecular Formula | C34H31FN4O4 |
| Molecular Weight | 578.64 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(2-methylphenyl)methyl]amino]-2-(3-fluorophenyl)acetamide |
| SMILES | Cc1ccccc1CN(C(=O)CN1C(=O)C(=O)c2ccccc21)C(C(=O)Nc1ccc(N(C)C)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C34H31FN4O4/c1-22-9-4-5-10-24(22)20-39(30(40)21-38-29-14-7-6-13-28(29)32(41)34(38)43)31(23-11-8-12-25(35)19-23)33(42)36-26-15-17-27(18-16-26)37(2)3/h4-19,31H,20-21H2,1-3H3,(H,36,42) |
| InChIKey | BRFDTDAENZKCLE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.64 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|