C33H28FN3O6 — CID 43819477
2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(2-fluorophenyl)methyl]amino]-2-(3-methoxyphenyl)-N-(4-methoxyphenyl)acetamide (PubChem CID 43819477) has the molecular formula C33H28FN3O6 and a molecular weight of 581.60 g/mol. Its IUPAC name is 2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(2-fluorophenyl)methyl]amino]-2-(3-methoxyphenyl)-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(2-fluorophenyl)methyl]amino]-2-(3-methoxyphenyl)-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 43819477 |
| Molecular Formula | C33H28FN3O6 |
| Molecular Weight | 581.60 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | 2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(2-fluorophenyl)methyl]amino]-2-(3-methoxyphenyl)-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)C(c2cccc(OC)c2)N(Cc2ccccc2F)C(=O)CN2C(=O)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C33H28FN3O6/c1-42-24-16-14-23(15-17-24)35-32(40)30(21-9-7-10-25(18-21)43-2)37(19-22-8-3-5-12-27(22)34)29(38)20-36-28-13-6-4-11-26(28)31(39)33(36)41/h3-18,30H,19-20H2,1-2H3,(H,35,40) |
| InChIKey | JZCLWMHLTANACI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.60 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|