C32H25F2N3O5 — CID 43819548
2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-2-(3-fluorophenyl)-N-(4-methoxyphenyl)acetamide (PubChem CID 43819548) has the molecular formula C32H25F2N3O5 and a molecular weight of 569.56 g/mol. Its IUPAC name is 2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-2-(3-fluorophenyl)-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-2-(3-fluorophenyl)-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 43819548 |
| Molecular Formula | C32H25F2N3O5 |
| Molecular Weight | 569.56 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | 2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-2-(3-fluorophenyl)-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)C(c2cccc(F)c2)N(Cc2ccc(F)cc2)C(=O)CN2C(=O)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C32H25F2N3O5/c1-42-25-15-13-24(14-16-25)35-31(40)29(21-5-4-6-23(34)17-21)37(18-20-9-11-22(33)12-10-20)28(38)19-36-27-8-3-2-7-26(27)30(39)32(36)41/h2-17,29H,18-19H2,1H3,(H,35,40) |
| InChIKey | YCIUYGPVTHAYGT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|