C32H30FN3O5 — CID 5079094
2-cyclohex-3-en-1-yl-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(4-methoxyphenyl)acetamide (PubChem CID 5079094) has the molecular formula C32H30FN3O5 and a molecular weight of 555.61 g/mol. Its IUPAC name is 2-cyclohex-3-en-1-yl-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-cyclohex-3-en-1-yl-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 5079094 |
| Molecular Formula | C32H30FN3O5 |
| Molecular Weight | 555.61 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | 2-cyclohex-3-en-1-yl-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)C(C2CC=CCC2)N(Cc2ccc(F)cc2)C(=O)CN2C(=O)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C32H30FN3O5/c1-41-25-17-15-24(16-18-25)34-31(39)29(22-7-3-2-4-8-22)36(19-21-11-13-23(33)14-12-21)28(37)20-35-27-10-6-5-9-26(27)30(38)32(35)40/h2-3,5-6,9-18,22,29H,4,7-8,19-20H2,1H3,(H,34,39) |
| InChIKey | VUERZEGJNAPGOI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|