C36H32N4O7S — CID 43820003
N-(1,3-benzodioxol-5-yl)-2-cyclohex-3-en-1-yl-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]amino]acetamide (PubChem CID 43820003) has the molecular formula C36H32N4O7S and a molecular weight of 664.74 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-cyclohex-3-en-1-yl-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]amino]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-cyclohex-3-en-1-yl-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]amino]acetamide |
|---|---|
| PubChem CID | 43820003 |
| Molecular Formula | C36H32N4O7S |
| Molecular Weight | 664.74 g/mol |
| Exact Mass | 664.20 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-cyclohex-3-en-1-yl-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]amino]acetamide |
| SMILES | COc1ccc(-c2csc(CN(C(=O)CN3C(=O)C(=O)c4ccccc43)C(C(=O)Nc3ccc4c(c3)OCO4)C3CC=CCC3)n2)cc1 |
| InChI | InChI=1S/C36H32N4O7S/c1-45-25-14-11-22(12-15-25)27-20-48-31(38-27)18-40(32(41)19-39-28-10-6-5-9-26(28)34(42)36(39)44)33(23-7-3-2-4-8-23)35(43)37-24-13-16-29-30(17-24)47-21-46-29/h2-3,5-6,9-17,20,23,33H,4,7-8,18-19,21H2,1H3,(H,37,43) |
| InChIKey | QRDHOXFTGFVSAL-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 127.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.74 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|