C31H28N4O4S — CID 4144081
2-[benzyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-[4-(dimethylamino)phenyl]-2-thiophen-2-ylacetamide (PubChem CID 4144081) has the molecular formula C31H28N4O4S and a molecular weight of 552.66 g/mol. Its IUPAC name is 2-[benzyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-[4-(dimethylamino)phenyl]-2-thiophen-2-ylacetamide.
| Compound Name | 2-[benzyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-[4-(dimethylamino)phenyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 4144081 |
| Molecular Formula | C31H28N4O4S |
| Molecular Weight | 552.66 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | 2-[benzyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-[4-(dimethylamino)phenyl]-2-thiophen-2-ylacetamide |
| SMILES | CN(C)c1ccc(NC(=O)C(c2cccs2)N(Cc2ccccc2)C(=O)CN2C(=O)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C31H28N4O4S/c1-33(2)23-16-14-22(15-17-23)32-30(38)28(26-13-8-18-40-26)35(19-21-9-4-3-5-10-21)27(36)20-34-25-12-7-6-11-24(25)29(37)31(34)39/h3-18,28H,19-20H2,1-2H3,(H,32,38) |
| InChIKey | HSFXDOZQFTUHEL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.66 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|