C32H34N4O4 — CID 3483081
1-[benzyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-[4-(dimethylamino)phenyl]cyclohexane-1-carboxamide (PubChem CID 3483081) has the molecular formula C32H34N4O4 and a molecular weight of 538.65 g/mol. Its IUPAC name is 1-[benzyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-[4-(dimethylamino)phenyl]cyclohexane-1-carboxamide.
| Compound Name | 1-[benzyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-[4-(dimethylamino)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 3483081 |
| Molecular Formula | C32H34N4O4 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | 1-[benzyl-[2-(2,3-dioxoindol-1-yl)acetyl]amino]-N-[4-(dimethylamino)phenyl]cyclohexane-1-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)C2(N(Cc3ccccc3)C(=O)CN3C(=O)C(=O)c4ccccc43)CCCCC2)cc1 |
| InChI | InChI=1S/C32H34N4O4/c1-34(2)25-17-15-24(16-18-25)33-31(40)32(19-9-4-10-20-32)36(21-23-11-5-3-6-12-23)28(37)22-35-27-14-8-7-13-26(27)29(38)30(35)39/h3,5-8,11-18H,4,9-10,19-22H2,1-2H3,(H,33,40) |
| InChIKey | WVXYDPDVMPNCLL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|