C30H33ClN6O2 — CID 43820337
1-[[2-(benzotriazol-1-yl)acetyl]-[(4-chlorophenyl)methyl]amino]-N-[4-(dimethylamino)phenyl]cyclohexane-1-carboxamide (PubChem CID 43820337) has the molecular formula C30H33ClN6O2 and a molecular weight of 545.09 g/mol. Its IUPAC name is 1-[[2-(benzotriazol-1-yl)acetyl]-[(4-chlorophenyl)methyl]amino]-N-[4-(dimethylamino)phenyl]cyclohexane-1-carboxamide.
| Compound Name | 1-[[2-(benzotriazol-1-yl)acetyl]-[(4-chlorophenyl)methyl]amino]-N-[4-(dimethylamino)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 43820337 |
| Molecular Formula | C30H33ClN6O2 |
| Molecular Weight | 545.09 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | 1-[[2-(benzotriazol-1-yl)acetyl]-[(4-chlorophenyl)methyl]amino]-N-[4-(dimethylamino)phenyl]cyclohexane-1-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)C2(N(Cc3ccc(Cl)cc3)C(=O)Cn3nnc4ccccc43)CCCCC2)cc1 |
| InChI | InChI=1S/C30H33ClN6O2/c1-35(2)25-16-14-24(15-17-25)32-29(39)30(18-6-3-7-19-30)36(20-22-10-12-23(31)13-11-22)28(38)21-37-27-9-5-4-8-26(27)33-34-37/h4-5,8-17H,3,6-7,18-21H2,1-2H3,(H,32,39) |
| InChIKey | JZWZWGLNNZXDME-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.09 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|