C33H38FN5O2S — CID 4101382
N-[4-(dimethylamino)phenyl]-1-[(2-fluorophenyl)methyl-[2-(4-phenyl-2-sulfanylideneimidazolidin-1-yl)acetyl]amino]cyclohexane-1-carboxamide (PubChem CID 4101382) has the molecular formula C33H38FN5O2S and a molecular weight of 587.77 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-1-[(2-fluorophenyl)methyl-[2-(4-phenyl-2-sulfanylideneimidazolidin-1-yl)acetyl]amino]cyclohexane-1-carboxamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-1-[(2-fluorophenyl)methyl-[2-(4-phenyl-2-sulfanylideneimidazolidin-1-yl)acetyl]amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 4101382 |
| Molecular Formula | C33H38FN5O2S |
| Molecular Weight | 587.77 g/mol |
| Exact Mass | 587.27 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-1-[(2-fluorophenyl)methyl-[2-(4-phenyl-2-sulfanylideneimidazolidin-1-yl)acetyl]amino]cyclohexane-1-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)C2(N(Cc3ccccc3F)C(=O)CN3CC(c4ccccc4)NC3=S)CCCCC2)cc1 |
| InChI | InChI=1S/C33H38FN5O2S/c1-37(2)27-17-15-26(16-18-27)35-31(41)33(19-9-4-10-20-33)39(21-25-13-7-8-14-28(25)34)30(40)23-38-22-29(36-32(38)42)24-11-5-3-6-12-24/h3,5-8,11-18,29H,4,9-10,19-23H2,1-2H3,(H,35,41)(H,36,42) |
| InChIKey | ZMLDSSDWIOMNFW-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.77 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|