C33H39N5O4S — CID 5215214
1-[furan-2-ylmethyl-[2-(4-phenyl-2-sulfanylideneimidazolidin-1-yl)acetyl]amino]-N-(4-morpholin-4-ylphenyl)cyclohexane-1-carboxamide (PubChem CID 5215214) has the molecular formula C33H39N5O4S and a molecular weight of 601.77 g/mol. Its IUPAC name is 1-[furan-2-ylmethyl-[2-(4-phenyl-2-sulfanylideneimidazolidin-1-yl)acetyl]amino]-N-(4-morpholin-4-ylphenyl)cyclohexane-1-carboxamide.
| Compound Name | 1-[furan-2-ylmethyl-[2-(4-phenyl-2-sulfanylideneimidazolidin-1-yl)acetyl]amino]-N-(4-morpholin-4-ylphenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 5215214 |
| Molecular Formula | C33H39N5O4S |
| Molecular Weight | 601.77 g/mol |
| Exact Mass | 601.27 |
| IUPAC Name | 1-[furan-2-ylmethyl-[2-(4-phenyl-2-sulfanylideneimidazolidin-1-yl)acetyl]amino]-N-(4-morpholin-4-ylphenyl)cyclohexane-1-carboxamide |
| SMILES | O=C(CN1CC(c2ccccc2)NC1=S)N(Cc1ccco1)C1(C(=O)Nc2ccc(N3CCOCC3)cc2)CCCCC1 |
| InChI | InChI=1S/C33H39N5O4S/c39-30(24-37-23-29(35-32(37)43)25-8-3-1-4-9-25)38(22-28-10-7-19-42-28)33(15-5-2-6-16-33)31(40)34-26-11-13-27(14-12-26)36-17-20-41-21-18-36/h1,3-4,7-14,19,29H,2,5-6,15-18,20-24H2,(H,34,40)(H,35,43) |
| InChIKey | XYURGDXIDJATMI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.77 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|