C39H46N4O3 — CID 98203285
1-[benzyl-[2-[(1S,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]amino]-N-(4-morpholin-4-ylphenyl)cyclopentane-1-carboxamide (PubChem CID 98203285) has the molecular formula C39H46N4O3 and a molecular weight of 618.82 g/mol. Its IUPAC name is 1-[benzyl-[2-[(1S,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]amino]-N-(4-morpholin-4-ylphenyl)cyclopentane-1-carboxamide.
| Compound Name | 1-[benzyl-[2-[(1S,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]amino]-N-(4-morpholin-4-ylphenyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 98203285 |
| Molecular Formula | C39H46N4O3 |
| Molecular Weight | 618.82 g/mol |
| Exact Mass | 618.36 |
| IUPAC Name | 1-[benzyl-[2-[(1S,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]amino]-N-(4-morpholin-4-ylphenyl)cyclopentane-1-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1[C@H]1[C@H](CC(=O)N(Cc2ccccc2)C2(C(=O)Nc3ccc(N4CCOCC4)cc3)CCCC2)C1(C)C |
| InChI | InChI=1S/C39H46N4O3/c1-27-35(31-13-7-8-14-33(31)40-27)36-32(38(36,2)3)25-34(44)43(26-28-11-5-4-6-12-28)39(19-9-10-20-39)37(45)41-29-15-17-30(18-16-29)42-21-23-46-24-22-42/h4-8,11-18,32,36,40H,9-10,19-26H2,1-3H3,(H,41,45)/t32-,36+/m0/s1 |
| InChIKey | PVYOUBTYARWHJB-LBHUVFDKSA-N |
| XLogP | 7.42 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.82 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|