C39H44F3N3O2S — CID 99690556
4-[[2-[(1S,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]-[[4-(trifluoromethyl)phenyl]methyl]amino]-N-(2,4,6-trimethylphenyl)thiane-4-carboxamide (PubChem CID 99690556) has the molecular formula C39H44F3N3O2S and a molecular weight of 675.86 g/mol. Its IUPAC name is 4-[[2-[(1S,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]-[[4-(trifluoromethyl)phenyl]methyl]amino]-N-(2,4,6-trimethylphenyl)thiane-4-carboxamide.
| Compound Name | 4-[[2-[(1S,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]-[[4-(trifluoromethyl)phenyl]methyl]amino]-N-(2,4,6-trimethylphenyl)thiane-4-carboxamide |
|---|---|
| PubChem CID | 99690556 |
| Molecular Formula | C39H44F3N3O2S |
| Molecular Weight | 675.86 g/mol |
| Exact Mass | 675.31 |
| IUPAC Name | 4-[[2-[(1S,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]-[[4-(trifluoromethyl)phenyl]methyl]amino]-N-(2,4,6-trimethylphenyl)thiane-4-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)C2(N(Cc3ccc(C(F)(F)F)cc3)C(=O)C[C@H]3[C@H](c4c(C)[nH]c5ccccc45)C3(C)C)CCSCC2)c(C)c1 |
| InChI | InChI=1S/C39H44F3N3O2S/c1-23-19-24(2)35(25(3)20-23)44-36(47)38(15-17-48-18-16-38)45(22-27-11-13-28(14-12-27)39(40,41)42)32(46)21-30-34(37(30,5)6)33-26(4)43-31-10-8-7-9-29(31)33/h7-14,19-20,30,34,43H,15-18,21-22H2,1-6H3,(H,44,47)/t30-,34+/m0/s1 |
| InChIKey | YFQCEHSIKFJDFH-BFGHFXMOSA-N |
| XLogP | 9.48 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.86 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|