C39H45FN4O3S — CID 17037701
4-[[2-[(1R,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]-[(2-fluorophenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)thiane-4-carboxamide (PubChem CID 17037701) has the molecular formula C39H45FN4O3S and a molecular weight of 668.88 g/mol. Its IUPAC name is 4-[[2-[(1R,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]-[(2-fluorophenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)thiane-4-carboxamide.
| Compound Name | 4-[[2-[(1R,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]-[(2-fluorophenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)thiane-4-carboxamide |
|---|---|
| PubChem CID | 17037701 |
| Molecular Formula | C39H45FN4O3S |
| Molecular Weight | 668.88 g/mol |
| Exact Mass | 668.32 |
| IUPAC Name | 4-[[2-[(1R,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]-[(2-fluorophenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)thiane-4-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1[C@H]1[C@@H](CC(=O)N(Cc2ccccc2F)C2(C(=O)Nc3ccc(N4CCOCC4)cc3)CCSCC2)C1(C)C |
| InChI | InChI=1S/C39H45FN4O3S/c1-26-35(30-9-5-7-11-33(30)41-26)36-31(38(36,2)3)24-34(45)44(25-27-8-4-6-10-32(27)40)39(16-22-48-23-17-39)37(46)42-28-12-14-29(15-13-28)43-18-20-47-21-19-43/h4-15,31,36,41H,16-25H2,1-3H3,(H,42,46)/t31-,36-/m1/s1 |
| InChIKey | ORJCWKYKVNPMJA-RRTCDKLQSA-N |
| XLogP | 7.52 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.88 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|