C38H46N4O4 — CID 17037661
1-[[2-[(1R,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]-(furan-2-ylmethyl)amino]-N-(4-morpholin-4-ylphenyl)cyclohexane-1-carboxamide (PubChem CID 17037661) has the molecular formula C38H46N4O4 and a molecular weight of 622.81 g/mol. Its IUPAC name is 1-[[2-[(1R,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]-(furan-2-ylmethyl)amino]-N-(4-morpholin-4-ylphenyl)cyclohexane-1-carboxamide.
| Compound Name | 1-[[2-[(1R,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]-(furan-2-ylmethyl)amino]-N-(4-morpholin-4-ylphenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 17037661 |
| Molecular Formula | C38H46N4O4 |
| Molecular Weight | 622.81 g/mol |
| Exact Mass | 622.35 |
| IUPAC Name | 1-[[2-[(1R,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]-(furan-2-ylmethyl)amino]-N-(4-morpholin-4-ylphenyl)cyclohexane-1-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1[C@H]1[C@@H](CC(=O)N(Cc2ccco2)C2(C(=O)Nc3ccc(N4CCOCC4)cc3)CCCCC2)C1(C)C |
| InChI | InChI=1S/C38H46N4O4/c1-26-34(30-11-5-6-12-32(30)39-26)35-31(37(35,2)3)24-33(43)42(25-29-10-9-21-46-29)38(17-7-4-8-18-38)36(44)40-27-13-15-28(16-14-27)41-19-22-45-23-20-41/h5-6,9-16,21,31,35,39H,4,7-8,17-20,22-25H2,1-3H3,(H,40,44)/t31-,35-/m1/s1 |
| InChIKey | DHULVDFFUURPKY-CYEXUTLASA-N |
| XLogP | 7.41 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.81 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|