C33H42N4O2 — CID 92524778
1-[cyclopropyl-[2-[(1S,3R)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]amino]-N-[4-(dimethylamino)phenyl]cyclopentane-1-carboxamide (PubChem CID 92524778) has the molecular formula C33H42N4O2 and a molecular weight of 526.73 g/mol. Its IUPAC name is 1-[cyclopropyl-[2-[(1S,3R)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]amino]-N-[4-(dimethylamino)phenyl]cyclopentane-1-carboxamide.
| Compound Name | 1-[cyclopropyl-[2-[(1S,3R)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]amino]-N-[4-(dimethylamino)phenyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 92524778 |
| Molecular Formula | C33H42N4O2 |
| Molecular Weight | 526.73 g/mol |
| Exact Mass | 526.33 |
| IUPAC Name | 1-[cyclopropyl-[2-[(1S,3R)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]amino]-N-[4-(dimethylamino)phenyl]cyclopentane-1-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1[C@@H]1[C@H](CC(=O)N(C2CC2)C2(C(=O)Nc3ccc(N(C)C)cc3)CCCC2)C1(C)C |
| InChI | InChI=1S/C33H42N4O2/c1-21-29(25-10-6-7-11-27(25)34-21)30-26(32(30,2)3)20-28(38)37(24-16-17-24)33(18-8-9-19-33)31(39)35-22-12-14-23(15-13-22)36(4)5/h6-7,10-15,24,26,30,34H,8-9,16-20H2,1-5H3,(H,35,39)/t26-,30-/m0/s1 |
| InChIKey | AIRJAUSLSZZDQU-YZNIXAGQSA-N |
| XLogP | 6.61 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.73 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|