C40H48N4O3 — CID 17037649
1-[benzyl-[2-[(1R,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]amino]-N-(4-morpholin-4-ylphenyl)cyclohexane-1-carboxamide (PubChem CID 17037649) has the molecular formula C40H48N4O3 and a molecular weight of 632.85 g/mol. Its IUPAC name is 1-[benzyl-[2-[(1R,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]amino]-N-(4-morpholin-4-ylphenyl)cyclohexane-1-carboxamide.
| Compound Name | 1-[benzyl-[2-[(1R,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]amino]-N-(4-morpholin-4-ylphenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 17037649 |
| Molecular Formula | C40H48N4O3 |
| Molecular Weight | 632.85 g/mol |
| Exact Mass | 632.37 |
| IUPAC Name | 1-[benzyl-[2-[(1R,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]amino]-N-(4-morpholin-4-ylphenyl)cyclohexane-1-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1[C@H]1[C@@H](CC(=O)N(Cc2ccccc2)C2(C(=O)Nc3ccc(N4CCOCC4)cc3)CCCCC2)C1(C)C |
| InChI | InChI=1S/C40H48N4O3/c1-28-36(32-14-8-9-15-34(32)41-28)37-33(39(37,2)3)26-35(45)44(27-29-12-6-4-7-13-29)40(20-10-5-11-21-40)38(46)42-30-16-18-31(19-17-30)43-22-24-47-25-23-43/h4,6-9,12-19,33,37,41H,5,10-11,20-27H2,1-3H3,(H,42,46)/t33-,37-/m1/s1 |
| InChIKey | CJXLVMXONMMJBI-PZSMLTKBSA-N |
| XLogP | 7.81 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.85 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|