C39H49N3O2S — CID 17037698
N-(1-adamantyl)-4-[benzyl-[2-[(1R,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]amino]thiane-4-carboxamide (PubChem CID 17037698) has the molecular formula C39H49N3O2S and a molecular weight of 623.91 g/mol. Its IUPAC name is N-(1-adamantyl)-4-[benzyl-[2-[(1R,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]amino]thiane-4-carboxamide.
| Compound Name | N-(1-adamantyl)-4-[benzyl-[2-[(1R,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]amino]thiane-4-carboxamide |
|---|---|
| PubChem CID | 17037698 |
| Molecular Formula | C39H49N3O2S |
| Molecular Weight | 623.91 g/mol |
| Exact Mass | 623.35 |
| IUPAC Name | N-(1-adamantyl)-4-[benzyl-[2-[(1R,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]amino]thiane-4-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1[C@H]1[C@@H](CC(=O)N(Cc2ccccc2)C2(C(=O)NC34CC5CC(CC(C5)C3)C4)CCSCC2)C1(C)C |
| InChI | InChI=1S/C39H49N3O2S/c1-25-34(30-11-7-8-12-32(30)40-25)35-31(37(35,2)3)20-33(43)42(24-26-9-5-4-6-10-26)39(13-15-45-16-14-39)36(44)41-38-21-27-17-28(22-38)19-29(18-27)23-38/h4-12,27-29,31,35,40H,13-24H2,1-3H3,(H,41,44)/t27?,28?,29?,31-,35-,38?/m1/s1 |
| InChIKey | LDFXDGBLHRFPSM-ONEAXSQQSA-N |
| XLogP | 7.99 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.91 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|