C35H42N4O3S — CID 98203110
N-[4-(dimethylamino)phenyl]-4-[[2-[(1R,3R)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]-(furan-2-ylmethyl)amino]thiane-4-carboxamide (PubChem CID 98203110) has the molecular formula C35H42N4O3S and a molecular weight of 598.81 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-4-[[2-[(1R,3R)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]-(furan-2-ylmethyl)amino]thiane-4-carboxamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-4-[[2-[(1R,3R)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]-(furan-2-ylmethyl)amino]thiane-4-carboxamide |
|---|---|
| PubChem CID | 98203110 |
| Molecular Formula | C35H42N4O3S |
| Molecular Weight | 598.81 g/mol |
| Exact Mass | 598.30 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-4-[[2-[(1R,3R)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]acetyl]-(furan-2-ylmethyl)amino]thiane-4-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1[C@@H]1[C@@H](CC(=O)N(Cc2ccco2)C2(C(=O)Nc3ccc(N(C)C)cc3)CCSCC2)C1(C)C |
| InChI | InChI=1S/C35H42N4O3S/c1-23-31(27-10-6-7-11-29(27)36-23)32-28(34(32,2)3)21-30(40)39(22-26-9-8-18-42-26)35(16-19-43-20-17-35)33(41)37-24-12-14-25(15-13-24)38(4)5/h6-15,18,28,32,36H,16-17,19-22H2,1-5H3,(H,37,41)/t28-,32+/m1/s1 |
| InChIKey | RMECCSSETBXNCF-NSJVFKKDSA-N |
| XLogP | 7.20 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.81 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|