C41H41N5O5 — CID 99650044
(2S,4aR,9aS)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-(pyridin-3-ylmethyl)amino]-N-(4-morpholin-4-ylphenyl)-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide (PubChem CID 99650044) has the molecular formula C41H41N5O5 and a molecular weight of 683.81 g/mol. Its IUPAC name is (2S,4aR,9aS)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-(pyridin-3-ylmethyl)amino]-N-(4-morpholin-4-ylphenyl)-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide.
| Compound Name | (2S,4aR,9aS)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-(pyridin-3-ylmethyl)amino]-N-(4-morpholin-4-ylphenyl)-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide |
|---|---|
| PubChem CID | 99650044 |
| Molecular Formula | C41H41N5O5 |
| Molecular Weight | 683.81 g/mol |
| Exact Mass | 683.31 |
| IUPAC Name | (2S,4aR,9aS)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-(pyridin-3-ylmethyl)amino]-N-(4-morpholin-4-ylphenyl)-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide |
| SMILES | O=C1c2ccccc2C(=O)N1CC(=O)N(Cc1cccnc1)[C@@]1(C(=O)Nc2ccc(N3CCOCC3)cc2)CC[C@@H]2Cc3ccccc3C[C@H]2C1 |
| InChI | InChI=1S/C41H41N5O5/c47-37(27-45-38(48)35-9-3-4-10-36(35)39(45)49)46(26-28-6-5-17-42-25-28)41(16-15-31-22-29-7-1-2-8-30(29)23-32(31)24-41)40(50)43-33-11-13-34(14-12-33)44-18-20-51-21-19-44/h1-14,17,25,31-32H,15-16,18-24,26-27H2,(H,43,50)/t31-,32+,41+/m1/s1 |
| InChIKey | MRJHOGFBTHJIGY-FZHPJRCUSA-N |
| XLogP | 5.14 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.81 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|